C20H17ClFN7O2 — CID 148789102
N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3-chloro-4-fluorophenyl)imidazo[1,2-c]pyrimidin-5-amine (PubChem CID 148789102) has the molecular formula C20H17ClFN7O2 and a molecular weight of 441.85 g/mol. Its IUPAC name is N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3-chloro-4-fluorophenyl)imidazo[1,2-c]pyrimidin-5-amine.
| Compound Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3-chloro-4-fluorophenyl)imidazo[1,2-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 148789102 |
| Molecular Formula | C20H17ClFN7O2 |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3-chloro-4-fluorophenyl)imidazo[1,2-c]pyrimidin-5-amine |
| SMILES | Nc1nc(CCCNc2nc(-c3ccc(F)c(Cl)c3)cc3nccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17ClFN7O2/c21-14-10-12(3-5-15(14)22)16-11-18-24-8-9-28(18)20(27-16)25-7-1-2-13-4-6-17(29(30)31)19(23)26-13/h3-6,8-11H,1-2,7H2,(H2,23,26)(H,25,27) |
| InChIKey | OLUNFKWJHHWIBJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|