C57H39N7 — CID 148796411
4-(2-phenylimidazo[1,2-a]pyridin-3-yl)-N,N-bis[4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]aniline (PubChem CID 148796411) has the molecular formula C57H39N7 and a molecular weight of 821.99 g/mol. Its IUPAC name is 4-(2-phenylimidazo[1,2-a]pyridin-3-yl)-N,N-bis[4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]aniline.
| Compound Name | 4-(2-phenylimidazo[1,2-a]pyridin-3-yl)-N,N-bis[4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 148796411 |
| Molecular Formula | C57H39N7 |
| Molecular Weight | 821.99 g/mol |
| Exact Mass | 821.33 |
| IUPAC Name | 4-(2-phenylimidazo[1,2-a]pyridin-3-yl)-N,N-bis[4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]aniline |
| SMILES | c1ccc(-c2nc3ccccn3c2-c2ccc(N(c3ccc(-c4c(-c5ccccc5)nc5ccccn45)cc3)c3ccc(-c4c(-c5ccccc5)nc5ccccn45)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H39N7/c1-4-16-40(17-5-1)52-55(61-37-13-10-22-49(61)58-52)43-25-31-46(32-26-43)64(47-33-27-44(28-34-47)56-53(41-18-6-2-7-19-41)59-50-23-11-14-38-62(50)56)48-35-29-45(30-36-48)57-54(42-20-8-3-9-21-42)60-51-24-12-15-39-63(51)57/h1-39H |
| InChIKey | ONEGCUHABIEGCA-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.99 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |