C13H17NO — CID 14879705
(4aR,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-9-ol (PubChem CID 14879705) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (4aR,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-9-ol.
| Compound Name | (4aR,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-9-ol |
|---|---|
| PubChem CID | 14879705 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (4aR,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-9-ol |
| SMILES | Oc1cccc2c1C[C@@H]1NCCC[C@@H]1C2 |
| InChI | InChI=1S/C13H17NO/c15-13-5-1-3-9-7-10-4-2-6-14-12(10)8-11(9)13/h1,3,5,10,12,14-15H,2,4,6-8H2/t10-,12+/m1/s1 |
| InChIKey | ZEGPLOZRDHDXHP-PWSUYJOCSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |