C11H13NO3 — CID 148797073
7-hydroxy-5-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-oxireno[2,3-c]isochromene-3-carbonitrile (PubChem CID 148797073) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 7-hydroxy-5-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-oxireno[2,3-c]isochromene-3-carbonitrile.
| Compound Name | 7-hydroxy-5-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-oxireno[2,3-c]isochromene-3-carbonitrile |
|---|---|
| PubChem CID | 148797073 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 7-hydroxy-5-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-oxireno[2,3-c]isochromene-3-carbonitrile |
| SMILES | CC1=CC(O)C2C(C1)C(C#N)OC1OC12 |
| InChI | InChI=1S/C11H13NO3/c1-5-2-6-8(4-12)14-11-10(15-11)9(6)7(13)3-5/h3,6-11,13H,2H2,1H3 |
| InChIKey | ONHINMYSDBODDW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|