C29H37N3O2S — CID 14879772
N-[(6aR,10aR,11R)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-yl]-4-(4-benzoylpiperazin-1-yl)butanamide (PubChem CID 14879772) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is N-[(6aR,10aR,11R)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-yl]-4-(4-benzoylpiperazin-1-yl)butanamide.
| Compound Name | N-[(6aR,10aR,11R)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-yl]-4-(4-benzoylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 14879772 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-[(6aR,10aR,11R)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-yl]-4-(4-benzoylpiperazin-1-yl)butanamide |
| SMILES | O=C(CCCN1CCN(C(=O)c2ccccc2)CC1)N[C@H]1c2ccccc2SC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C29H37N3O2S/c33-27(15-8-16-31-17-19-32(20-18-31)29(34)22-9-2-1-3-10-22)30-28-24-12-5-4-11-23(24)21-35-26-14-7-6-13-25(26)28/h1-3,6-7,9-10,13-14,23-24,28H,4-5,8,11-12,15-21H2,(H,30,33)/t23-,24+,28+/m0/s1 |
| InChIKey | WHQSXQKKJDLGCH-VYKTZEHYSA-N |
| XLogP | 4.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |