C10H10ClN3S — CID 1487988
4-(4-chlorophenyl)-2,5-dimethyl-1,2,4-triazole-3-thione (PubChem CID 1487988) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,5-dimethyl-1,2,4-triazole-3-thione.
| Compound Name | 4-(4-chlorophenyl)-2,5-dimethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 1487988 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2,5-dimethyl-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(C)c(=S)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10ClN3S/c1-7-12-13(2)10(15)14(7)9-5-3-8(11)4-6-9/h3-6H,1-2H3 |
| InChIKey | SANIEXHOBJGXSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|