C25H27FN4O2S — CID 148799255
4-[3-[[2-amino-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-pyridinyl]oxymethyl]-4-fluorophenyl]-2-methylbut-3-yn-2-ol (PubChem CID 148799255) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-pyridinyl]oxymethyl]-4-fluorophenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-pyridinyl]oxymethyl]-4-fluorophenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 148799255 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-[3-[[2-amino-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)-3-pyridinyl]oxymethyl]-4-fluorophenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc(F)c(COc2cc(-c3cnc(C4CCNCC4)s3)cnc2N)c1 |
| InChI | InChI=1S/C25H27FN4O2S/c1-25(2,31)8-5-16-3-4-20(26)19(11-16)15-32-21-12-18(13-29-23(21)27)22-14-30-24(33-22)17-6-9-28-10-7-17/h3-4,11-14,17,28,31H,6-7,9-10,15H2,1-2H3,(H2,27,29) |
| InChIKey | ONSAMRKSIPDACS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|