C21H19F2N3O3 — CID 148799258
N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)-3-piperidin-1-ylbenzamide (PubChem CID 148799258) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)-3-piperidin-1-ylbenzamide.
| Compound Name | N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)-3-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 148799258 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)-3-piperidin-1-ylbenzamide |
| SMILES | O=C(NC1=Nc2cc3c(cc2C1)OC(F)(F)O3)c1cccc(N2CCCCC2)c1 |
| InChI | InChI=1S/C21H19F2N3O3/c22-21(23)28-17-10-14-11-19(24-16(14)12-18(17)29-21)25-20(27)13-5-4-6-15(9-13)26-7-2-1-3-8-26/h4-6,9-10,12H,1-3,7-8,11H2,(H,24,25,27) |
| InChIKey | ONSARIZZRUXZQW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |