C8H9NO2 — CID 14880804
4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde (PubChem CID 14880804) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde.
| Compound Name | 4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 14880804 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbaldehyde |
| SMILES | O=Cc1noc2c1CCCC2 |
| InChI | InChI=1S/C8H9NO2/c10-5-7-6-3-1-2-4-8(6)11-9-7/h5H,1-4H2 |
| InChIKey | OBILEGQRRXMNDZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|