C18H15ClN4O — CID 148810216
9-(2-chlorophenyl)-13-methoxy-6-methyl-2,4,8,12-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene (PubChem CID 148810216) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-13-methoxy-6-methyl-2,4,8,12-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene.
| Compound Name | 9-(2-chlorophenyl)-13-methoxy-6-methyl-2,4,8,12-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 148810216 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 9-(2-chlorophenyl)-13-methoxy-6-methyl-2,4,8,12-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3,6,8,10,12-hexaene |
| SMILES | COc1cc2c(cn1)C(c1ccccc1Cl)=NC1=C(C)CN=C1N2 |
| InChI | InChI=1S/C18H15ClN4O/c1-10-8-21-18-16(10)23-17(11-5-3-4-6-13(11)19)12-9-20-15(24-2)7-14(12)22-18/h3-7,9H,8H2,1-2H3,(H,21,22) |
| InChIKey | OPTPCUSMCAKIMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |