About 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one
5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one (PubChem CID 148812031) has the molecular formula C17H21F2N3O3S
and a molecular weight of 385.44 g/mol. Its IUPAC name is 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one |
| PubChem CID | 148812031 |
| Molecular Formula | C17H21F2N3O3S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one |
| SMILES | CCCC(F)(F)c1cnc(CS(C)(=O)=O)nc1-c1cc(C)c(=O)n(C)c1 |
| InChI | InChI=1S/C17H21F2N3O3S/c1-5-6-17(18,19)13-8-20-14(10-26(4,24)25)21-15(13)12-7-11(2)16(23)22(3)9-12/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | OQCGZJZSAXSIOF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one (CID 148812031) is 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one is CCCC(F)(F)c1cnc(CS(C)(=O)=O)nc1-c1cc(C)c(=O)n(C)c1.
What is the InChIKey of 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The InChIKey is OQCGZJZSAXSIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O3S/c1-5-6-17(18,19)13-8-20-14(10-26(4,24)25)21-15(13)12-7-11(2)16(23)22(3)9-12/h7-9H,5-6,10H2,1-4H3.
What are the key properties of 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one has a molecular weight of 385.44 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(1,1-difluorobutyl)-2-(methylsulfonylmethyl)pyrimidin-4-yl]-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 148812031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).