C31H40N4O8 — CID 14881414
2-methylpropyl N-[4-[4-(2-oxo-3,4-dihydro-1H-quinoline-6-carbonyl)piperazin-1-yl]-1-phenylbutyl]carbamate;oxalic acid (PubChem CID 14881414) has the molecular formula C31H40N4O8 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-methylpropyl N-[4-[4-(2-oxo-3,4-dihydro-1H-quinoline-6-carbonyl)piperazin-1-yl]-1-phenylbutyl]carbamate;oxalic acid.
| Compound Name | 2-methylpropyl N-[4-[4-(2-oxo-3,4-dihydro-1H-quinoline-6-carbonyl)piperazin-1-yl]-1-phenylbutyl]carbamate;oxalic acid |
|---|---|
| PubChem CID | 14881414 |
| Molecular Formula | C31H40N4O8 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 2-methylpropyl N-[4-[4-(2-oxo-3,4-dihydro-1H-quinoline-6-carbonyl)piperazin-1-yl]-1-phenylbutyl]carbamate;oxalic acid |
| SMILES | CC(C)COC(=O)NC(CCCN1CCN(C(=O)c2ccc3c(c2)CCC(=O)N3)CC1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H38N4O4.C2H2O4/c1-21(2)20-37-29(36)31-25(22-7-4-3-5-8-22)9-6-14-32-15-17-33(18-16-32)28(35)24-10-12-26-23(19-24)11-13-27(34)30-26;3-1(4)2(5)6/h3-5,7-8,10,12,19,21,25H,6,9,11,13-18,20H2,1-2H3,(H,30,34)(H,31,36);(H,3,4)(H,5,6) |
| InChIKey | GRMNNNPYDZUINY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|