C22H19ClN4O2 — CID 148816852
2-chloro-5-[5-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1H-imidazol-2-yl]pyridine (PubChem CID 148816852) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-chloro-5-[5-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1H-imidazol-2-yl]pyridine.
| Compound Name | 2-chloro-5-[5-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 148816852 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-chloro-5-[5-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1H-imidazol-2-yl]pyridine |
| SMILES | COc1cc(OCc2ccc(C)cn2)ccc1-c1cnc(-c2ccc(Cl)nc2)[nH]1 |
| InChI | InChI=1S/C22H19ClN4O2/c1-14-3-5-16(24-10-14)13-29-17-6-7-18(20(9-17)28-2)19-12-26-22(27-19)15-4-8-21(23)25-11-15/h3-12H,13H2,1-2H3,(H,26,27) |
| InChIKey | OQZOWOBUBCRGIO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|