About ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate
ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate (PubChem CID 1488175) has the molecular formula C11H18F3NO3
and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate |
| PubChem CID | 1488175 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C[C@H](O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO3/c1-2-18-10(17)8-3-5-15(6-4-8)7-9(16)11(12,13)14/h8-9,16H,2-7H2,1H3/t9-/m0/s1 |
| InChIKey | QIHJUGUQEBIIPU-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate (CID 1488175) is ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C[C@H](O)C(F)(F)F)CC1.
What is the InChIKey of ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate?
The InChIKey is QIHJUGUQEBIIPU-VIFPVBQESA-N. The full InChI is InChI=1S/C11H18F3NO3/c1-2-18-10(17)8-3-5-15(6-4-8)7-9(16)11(12,13)14/h8-9,16H,2-7H2,1H3/t9-/m0/s1.
What are the key properties of ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate?
ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate has a molecular weight of 269.26 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-4-carboxylate is sourced from PubChem (CID 1488175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).