C32H17I6O4S+ — CID 148818522
phenyl-bis[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium (PubChem CID 148818522) has the molecular formula C32H17I6O4S+ and a molecular weight of 1258.97 g/mol. Its IUPAC name is phenyl-bis[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium.
| Compound Name | phenyl-bis[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium |
|---|---|
| PubChem CID | 148818522 |
| Molecular Formula | C32H17I6O4S+ |
| Molecular Weight | 1258.97 g/mol |
| Exact Mass | 1258.51 |
| IUPAC Name | phenyl-bis[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc([S+](c2ccccc2)c2ccc(C(=O)Oc3c(I)cc(I)cc3I)cc2)cc1 |
| InChI | InChI=1S/C32H17I6O4S/c33-20-14-25(35)29(26(36)15-20)41-31(39)18-6-10-23(11-7-18)43(22-4-2-1-3-5-22)24-12-8-19(9-13-24)32(40)42-30-27(37)16-21(34)17-28(30)38/h1-17H/q+1 |
| InChIKey | ORHXQFWGWUWHSJ-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1258.97 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|