C17H15FN4O2 — CID 148820534
N-[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 148820534) has the molecular formula C17H15FN4O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | N-[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 148820534 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | N#CC1CC(F)CN1C(=O)CNC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C17H15FN4O2/c18-11-7-12(8-19)22(10-11)16(23)9-21-17(24)14-5-6-20-15-4-2-1-3-13(14)15/h1-6,11-12H,7,9-10H2,(H,21,24) |
| InChIKey | ORRRPUSEMSKTEW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |