About 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide
2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide (PubChem CID 1488248) has the molecular formula C15H14ClNO3S
and a molecular weight of 323.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide |
| PubChem CID | 1488248 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CS(=O)(=O)c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-17(13-7-3-2-4-8-13)15(18)11-21(19,20)14-9-5-6-12(16)10-14/h2-10H,11H2,1H3 |
| InChIKey | SLLOIXJZWAYOAL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide?
The IUPAC name of 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide (CID 1488248) is 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide.
What is the SMILES notation for 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide?
The canonical SMILES for 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide is CN(C(=O)CS(=O)(=O)c1cccc(Cl)c1)c1ccccc1.
What is the InChIKey of 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide?
The InChIKey is SLLOIXJZWAYOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO3S/c1-17(13-7-3-2-4-8-13)15(18)11-21(19,20)14-9-5-6-12(16)10-14/h2-10H,11H2,1H3.
What are the key properties of 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide?
2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide has a molecular weight of 323.80 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)sulfonyl-N-methyl-N-phenylacetamide is sourced from PubChem (CID 1488248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).