C34H41N3O5S — CID 14882561
3-methoxy-4-[[1-methyl-5-[2-methyl-3-oxo-3-(pentylamino)propyl]indol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide (PubChem CID 14882561) has the molecular formula C34H41N3O5S and a molecular weight of 603.79 g/mol. Its IUPAC name is 3-methoxy-4-[[1-methyl-5-[2-methyl-3-oxo-3-(pentylamino)propyl]indol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide.
| Compound Name | 3-methoxy-4-[[1-methyl-5-[2-methyl-3-oxo-3-(pentylamino)propyl]indol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 14882561 |
| Molecular Formula | C34H41N3O5S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 3-methoxy-4-[[1-methyl-5-[2-methyl-3-oxo-3-(pentylamino)propyl]indol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide |
| SMILES | CCCCCNC(=O)C(C)Cc1ccc2c(c1)c(Cc1ccc(C(=O)NS(=O)(=O)c3ccccc3C)cc1OC)cn2C |
| InChI | InChI=1S/C34H41N3O5S/c1-6-7-10-17-35-33(38)24(3)18-25-13-16-30-29(19-25)28(22-37(30)4)20-26-14-15-27(21-31(26)42-5)34(39)36-43(40,41)32-12-9-8-11-23(32)2/h8-9,11-16,19,21-22,24H,6-7,10,17-18,20H2,1-5H3,(H,35,38)(H,36,39) |
| InChIKey | WPGMNDBCATVCRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|