C18H14FNO2S — CID 148828044
ethyl 3-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]benzoate (PubChem CID 148828044) has the molecular formula C18H14FNO2S and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 3-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]benzoate.
| Compound Name | ethyl 3-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 148828044 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 3-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2csc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C18H14FNO2S/c1-2-22-18(21)13-7-5-6-12(10-13)16-11-23-17(20-16)14-8-3-4-9-15(14)19/h3-11H,2H2,1H3 |
| InChIKey | OTCSIXPTHMORFQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |