C37H34F3N3O10S2 — CID 148828661
2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]acetic acid (PubChem CID 148828661) has the molecular formula C37H34F3N3O10S2 and a molecular weight of 801.82 g/mol. Its IUPAC name is 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 148828661 |
| Molecular Formula | C37H34F3N3O10S2 |
| Molecular Weight | 801.82 g/mol |
| Exact Mass | 801.16 |
| IUPAC Name | 2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOc1ccc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C37H34F3N3O10S2/c38-37(39,40)28-21-25(53-20-19-52-22-30(44)45)5-10-29(28)43-35(48)31(54-26-6-1-23(2-7-26)33(46)41-11-15-50-16-12-41)32(36(43)49)55-27-8-3-24(4-9-27)34(47)42-13-17-51-18-14-42/h1-10,21H,11-20,22H2,(H,44,45) |
| InChIKey | OTFYAHAOXFGJEY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|