C19H25F2NO7 — CID 148828885
(2R,4S,5R)-4-(benzylamino)-2,3-difluoro-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 148828885) has the molecular formula C19H25F2NO7 and a molecular weight of 417.41 g/mol. Its IUPAC name is (2R,4S,5R)-4-(benzylamino)-2,3-difluoro-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-4-(benzylamino)-2,3-difluoro-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 148828885 |
| Molecular Formula | C19H25F2NO7 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (2R,4S,5R)-4-(benzylamino)-2,3-difluoro-5-(2-oxopropyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)C[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](F)(C(=O)O)C(F)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C19H25F2NO7/c1-10(24)7-12-14(22-8-11-5-3-2-4-6-11)17(20)19(21,18(27)28)29-16(12)15(26)13(25)9-23/h2-6,12-17,22-23,25-26H,7-9H2,1H3,(H,27,28)/t12-,13-,14+,15-,16?,17?,19-/m1/s1 |
| InChIKey | OTGYTUCCYWMYGO-VPGMQFARSA-N |
| XLogP | -0.06 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |