C21H19NO2 — CID 148832001
5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methyl-3-phenyl-1H-inden-2-one (PubChem CID 148832001) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methyl-3-phenyl-1H-inden-2-one.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methyl-3-phenyl-1H-inden-2-one |
|---|---|
| PubChem CID | 148832001 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methyl-3-phenyl-1H-inden-2-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)C(C)(c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C21H19NO2/c1-13-20(14(2)24-22-13)16-10-9-15-12-19(23)21(3,18(15)11-16)17-7-5-4-6-8-17/h4-11H,12H2,1-3H3 |
| InChIKey | OTWADUCPKXTNHQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |