About 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane
2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane (PubChem CID 148832596) has the molecular formula C10H17F3O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane |
| PubChem CID | 148832596 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane |
| SMILES | CC(C)(OCC(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C10H17F3O/c1-9(2,8-5-3-4-6-8)14-7-10(11,12)13/h8H,3-7H2,1-2H3 |
| InChIKey | OTYZDACCXCZDOF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane?
The IUPAC name of 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane (CID 148832596) is 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane.
What is the SMILES notation for 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane?
The canonical SMILES for 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane is CC(C)(OCC(F)(F)F)C1CCCC1.
What is the InChIKey of 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane?
The InChIKey is OTYZDACCXCZDOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O/c1-9(2,8-5-3-4-6-8)14-7-10(11,12)13/h8H,3-7H2,1-2H3.
What are the key properties of 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane?
2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane has a molecular weight of 210.24 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethoxy)propan-2-ylcyclopentane is sourced from PubChem (CID 148832596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).