C24H36N2O5S — CID 148834084
1-[5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione (PubChem CID 148834084) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is 1-[5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 148834084 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pentyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)COc1cccc(C2(CS(=O)(=O)CCCCCN3CCC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C24H36N2O5S/c1-23(2,3)17-31-20-9-7-8-19(16-20)24(11-12-24)18-32(29,30)15-6-4-5-13-26-14-10-21(27)25-22(26)28/h7-9,16H,4-6,10-15,17-18H2,1-3H3,(H,25,27,28) |
| InChIKey | OUGAZSOWDTYMLZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|