About N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide
N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide (PubChem CID 14883528) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide |
| PubChem CID | 14883528 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide |
| SMILES | CCC/C=C/C(O)C(CO)NC(C)=O |
| InChI | InChI=1S/C10H19NO3/c1-3-4-5-6-10(14)9(7-12)11-8(2)13/h5-6,9-10,12,14H,3-4,7H2,1-2H3,(H,11,13)/b6-5+ |
| InChIKey | JUSMCBHYYNHOOK-AATRIKPKSA-N |
| XLogP | 0.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide?
The IUPAC name of N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide (CID 14883528) is N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide.
What is the SMILES notation for N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide?
The canonical SMILES for N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide is CCC/C=C/C(O)C(CO)NC(C)=O.
What is the InChIKey of N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide?
The InChIKey is JUSMCBHYYNHOOK-AATRIKPKSA-N. The full InChI is InChI=1S/C10H19NO3/c1-3-4-5-6-10(14)9(7-12)11-8(2)13/h5-6,9-10,12,14H,3-4,7H2,1-2H3,(H,11,13)/b6-5+.
What are the key properties of N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide?
N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide has a molecular weight of 201.27 g/mol, XLogP of 0.20, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1,3-dihydroxyoct-4-en-2-yl]acetamide is sourced from PubChem (CID 14883528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).