C19H22N2O5 — CID 148835832
prop-2-enyl (6S,6aS)-3-hydroxy-2-methoxy-6,8-dimethyl-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 148835832) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is prop-2-enyl (6S,6aS)-3-hydroxy-2-methoxy-6,8-dimethyl-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl (6S,6aS)-3-hydroxy-2-methoxy-6,8-dimethyl-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 148835832 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | prop-2-enyl (6S,6aS)-3-hydroxy-2-methoxy-6,8-dimethyl-11-oxo-6a,7-dihydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(O)c(OC)cc2C(=O)N2C=C(C)C[C@H]2[C@@H]1C |
| InChI | InChI=1S/C19H22N2O5/c1-5-6-26-19(24)21-12(3)14-7-11(2)10-20(14)18(23)13-8-17(25-4)16(22)9-15(13)21/h5,8-10,12,14,22H,1,6-7H2,2-4H3/t12-,14-/m0/s1 |
| InChIKey | OUOKLBIABWLDQK-JSGCOSHPSA-N |
| XLogP | 3.05 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|