C12H14N2OS — CID 14883609
2-cyano-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide (PubChem CID 14883609) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-cyano-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide.
| Compound Name | 2-cyano-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 14883609 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-cyano-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide |
| SMILES | CSc1ccc(C(C)NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C12H14N2OS/c1-9(14-12(15)7-8-13)10-3-5-11(16-2)6-4-10/h3-6,9H,7H2,1-2H3,(H,14,15) |
| InChIKey | WDDIHLSPVCLUQU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |