About CID 148840635
CID 148840635 (PubChem CID 148840635) has the molecular formula C16H22BFNSi
and a molecular weight of 286.26 g/mol.
Molecular Properties
| Compound Name | CID 148840635 |
| PubChem CID | 148840635 |
| Molecular Formula | C16H22BFNSi |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)N1[B]C(c2ccc(F)cc2)=CC=C1 |
| InChI | InChI=1S/C16H22BFNSi/c1-16(2,3)20(4,5)19-12-6-7-15(17-19)13-8-10-14(18)11-9-13/h6-12H,1-5H3 |
| InChIKey | COWLJTSICRRQJG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 148840635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 148840635?
The IUPAC name of CID 148840635 (CID 148840635) is not available.
What is the SMILES notation for CID 148840635?
The canonical SMILES for CID 148840635 is CC(C)(C)[Si](C)(C)N1[B]C(c2ccc(F)cc2)=CC=C1.
What is the InChIKey of CID 148840635?
The InChIKey is COWLJTSICRRQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BFNSi/c1-16(2,3)20(4,5)19-12-6-7-15(17-19)13-8-10-14(18)11-9-13/h6-12H,1-5H3.
What are the key properties of CID 148840635?
CID 148840635 has a molecular weight of 286.26 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 148840635 is sourced from PubChem (CID 148840635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).