C20H38N2O5 — CID 14884272
2-[bis(2-hydroxyethyl)amino]ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one (PubChem CID 14884272) has the molecular formula C20H38N2O5 and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
|---|---|
| PubChem CID | 14884272 |
| Molecular Formula | C20H38N2O5 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1.OCCN(CCO)CCO |
| InChI | InChI=1S/C14H23NO2.C6H15NO3/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;8-4-1-7(2-5-9)3-6-10/h6,8,11,17H,7,9H2,1-5H3;8-10H,1-6H2 |
| InChIKey | VOMQYGIXWGQUET-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|