C6H15NO7P2 — CID 14884330
[(oxan-4-ylamino)-phosphonomethyl]phosphonic acid (PubChem CID 14884330) has the molecular formula C6H15NO7P2 and a molecular weight of 275.13 g/mol. Its IUPAC name is [(oxan-4-ylamino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(oxan-4-ylamino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 14884330 |
| Molecular Formula | C6H15NO7P2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | [(oxan-4-ylamino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NC1CCOCC1)P(=O)(O)O |
| InChI | InChI=1S/C6H15NO7P2/c8-15(9,10)6(16(11,12)13)7-5-1-3-14-4-2-5/h5-7H,1-4H2,(H2,8,9,10)(H2,11,12,13) |
| InChIKey | WPFJHVQDMZFAHO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|