C5H7N3S — CID 14884681
6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol (PubChem CID 14884681) has the molecular formula C5H7N3S and a molecular weight of 141.20 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol.
| Compound Name | 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol |
|---|---|
| PubChem CID | 14884681 |
| Molecular Formula | C5H7N3S |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-6-thiol |
| SMILES | SC1Cc2nncn2C1 |
| InChI | InChI=1S/C5H7N3S/c9-4-1-5-7-6-3-8(5)2-4/h3-4,9H,1-2H2 |
| InChIKey | IDXTZTFIQLYHFM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|