About 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium
3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium (PubChem CID 148849690) has the molecular formula C8H11F3NO3+
and a molecular weight of 226.17 g/mol. Its IUPAC name is 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium.
Molecular Properties
| Compound Name | 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium |
| PubChem CID | 148849690 |
| Molecular Formula | C8H11F3NO3+ |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium |
| SMILES | C/C(=C\C(=O)NCCC(=O)[OH2+])C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO3/c1-5(8(9,10)11)4-6(13)12-3-2-7(14)15/h4H,2-3H2,1H3,(H,12,13)(H,14,15)/p+1/b5-4+ |
| InChIKey | OXEOWVDRGHXJLP-SNAWJCMRSA-O |
| XLogP | 0.25 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium?
The IUPAC name of 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium (CID 148849690) is 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium.
What is the SMILES notation for 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium?
The canonical SMILES for 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium is C/C(=C\C(=O)NCCC(=O)[OH2+])C(F)(F)F.
What is the InChIKey of 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium?
The InChIKey is OXEOWVDRGHXJLP-SNAWJCMRSA-O. The full InChI is InChI=1S/C8H10F3NO3/c1-5(8(9,10)11)4-6(13)12-3-2-7(14)15/h4H,2-3H2,1H3,(H,12,13)(H,14,15)/p+1/b5-4+.
What are the key properties of 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium?
3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium has a molecular weight of 226.17 g/mol, XLogP of 0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]propanoyloxidanium is sourced from PubChem (CID 148849690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).