C8H13ClN3+ — CID 148849874
[6-(2,2-dimethylpropyl)-1,2,4-triazin-3-yl]chloranium (PubChem CID 148849874) has the molecular formula C8H13ClN3+ and a molecular weight of 186.67 g/mol. Its IUPAC name is [6-(2,2-dimethylpropyl)-1,2,4-triazin-3-yl]chloranium.
| Compound Name | [6-(2,2-dimethylpropyl)-1,2,4-triazin-3-yl]chloranium |
|---|---|
| PubChem CID | 148849874 |
| Molecular Formula | C8H13ClN3+ |
| Molecular Weight | 186.67 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | [6-(2,2-dimethylpropyl)-1,2,4-triazin-3-yl]chloranium |
| SMILES | CC(C)(C)Cc1cnc([ClH+])nn1 |
| InChI | InChI=1S/C8H13ClN3/c1-8(2,3)4-6-5-10-7(9)12-11-6/h5,9H,4H2,1-3H3/q+1 |
| InChIKey | OXFKVKZSLAZERD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.67 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |