About 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine
2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine (PubChem CID 1488511) has the molecular formula C15H16ClNO2S
and a molecular weight of 309.82 g/mol. Its IUPAC name is 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine |
| PubChem CID | 1488511 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2c(C)cccc2C)c(Cl)n1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-9-6-5-7-10(2)13(9)20(18,19)14-11(3)8-12(4)17-15(14)16/h5-8H,1-4H3 |
| InChIKey | XGKFNVJGJWBCCT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine?
The IUPAC name of 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine (CID 1488511) is 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine.
What is the SMILES notation for 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine?
The canonical SMILES for 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine is Cc1cc(C)c(S(=O)(=O)c2c(C)cccc2C)c(Cl)n1.
What is the InChIKey of 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine?
The InChIKey is XGKFNVJGJWBCCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO2S/c1-9-6-5-7-10(2)13(9)20(18,19)14-11(3)8-12(4)17-15(14)16/h5-8H,1-4H3.
What are the key properties of 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine?
2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine has a molecular weight of 309.82 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(2,6-dimethylphenyl)sulfonyl-4,6-dimethylpyridine is sourced from PubChem (CID 1488511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).