C30H40N4O2S — CID 148852990
6-tert-butyl-N-[3-[1-ethyl-5-[2-(1-methylsulfonylpiperidin-4-yl)ethyl]indol-2-yl]prop-2-ynyl]pyridin-3-amine (PubChem CID 148852990) has the molecular formula C30H40N4O2S and a molecular weight of 520.74 g/mol. Its IUPAC name is 6-tert-butyl-N-[3-[1-ethyl-5-[2-(1-methylsulfonylpiperidin-4-yl)ethyl]indol-2-yl]prop-2-ynyl]pyridin-3-amine.
| Compound Name | 6-tert-butyl-N-[3-[1-ethyl-5-[2-(1-methylsulfonylpiperidin-4-yl)ethyl]indol-2-yl]prop-2-ynyl]pyridin-3-amine |
|---|---|
| PubChem CID | 148852990 |
| Molecular Formula | C30H40N4O2S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 6-tert-butyl-N-[3-[1-ethyl-5-[2-(1-methylsulfonylpiperidin-4-yl)ethyl]indol-2-yl]prop-2-ynyl]pyridin-3-amine |
| SMILES | CCn1c(C#CCNc2ccc(C(C)(C)C)nc2)cc2cc(CCC3CCN(S(C)(=O)=O)CC3)ccc21 |
| InChI | InChI=1S/C30H40N4O2S/c1-6-34-27(8-7-17-31-26-12-14-29(32-22-26)30(2,3)4)21-25-20-24(11-13-28(25)34)10-9-23-15-18-33(19-16-23)37(5,35)36/h11-14,20-23,31H,6,9-10,15-19H2,1-5H3 |
| InChIKey | OXUZHEPPGPUMTR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|