C15H18BrN3O — CID 148853205
1-(4-bromophenyl)-3-[(1S)-2-methyl-1-(3H-pyrrol-2-yl)propyl]urea (PubChem CID 148853205) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1S)-2-methyl-1-(3H-pyrrol-2-yl)propyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[(1S)-2-methyl-1-(3H-pyrrol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 148853205 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1S)-2-methyl-1-(3H-pyrrol-2-yl)propyl]urea |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(Br)cc1)C1=NC=CC1 |
| InChI | InChI=1S/C15H18BrN3O/c1-10(2)14(13-4-3-9-17-13)19-15(20)18-12-7-5-11(16)6-8-12/h3,5-10,14H,4H2,1-2H3,(H2,18,19,20)/t14-/m0/s1 |
| InChIKey | OXVZQKJQJNGJSQ-AWEZNQCLSA-N |
| XLogP | 3.95 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |