C18H30O6 — CID 14885357
[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 2,2-dimethylpropanoate (PubChem CID 14885357) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 2,2-dimethylpropanoate.
| Compound Name | [(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14885357 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1[C@H](OC(=O)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H30O6/c1-9-11-14(24-18(7,8)22-11)13(21-15(19)16(2,3)4)12-10-20-17(5,6)23-12/h9,11-14H,1,10H2,2-8H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | QMBNZUZTOLSBQJ-AAVRWANBSA-N |
| XLogP | 2.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|