C15H27GeN — CID 148854408
N,2,3,4,5,6-hexamethyl-N-trimethylgermylaniline (PubChem CID 148854408) has the molecular formula C15H27GeN and a molecular weight of 294.00 g/mol. Its IUPAC name is N,2,3,4,5,6-hexamethyl-N-trimethylgermylaniline.
| Compound Name | N,2,3,4,5,6-hexamethyl-N-trimethylgermylaniline |
|---|---|
| PubChem CID | 148854408 |
| Molecular Formula | C15H27GeN |
| Molecular Weight | 294.00 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,2,3,4,5,6-hexamethyl-N-trimethylgermylaniline |
| SMILES | Cc1c(C)c(C)c(N(C)[Ge](C)(C)C)c(C)c1C |
| InChI | InChI=1S/C15H27GeN/c1-10-11(2)13(4)15(14(5)12(10)3)17(9)16(6,7)8/h1-9H3 |
| InChIKey | OYBRBZWRJCVEJX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |