C30H27NO8 — CID 14886046
1,6-dihydroxy-3,5-dimethoxy-2-[1-(7-methoxy-2-oxochromen-6-yl)-3-methylbut-2-enyl]-10H-acridin-9-one (PubChem CID 14886046) has the molecular formula C30H27NO8 and a molecular weight of 529.55 g/mol. Its IUPAC name is 1,6-dihydroxy-3,5-dimethoxy-2-[1-(7-methoxy-2-oxochromen-6-yl)-3-methylbut-2-enyl]-10H-acridin-9-one.
| Compound Name | 1,6-dihydroxy-3,5-dimethoxy-2-[1-(7-methoxy-2-oxochromen-6-yl)-3-methylbut-2-enyl]-10H-acridin-9-one |
|---|---|
| PubChem CID | 14886046 |
| Molecular Formula | C30H27NO8 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 1,6-dihydroxy-3,5-dimethoxy-2-[1-(7-methoxy-2-oxochromen-6-yl)-3-methylbut-2-enyl]-10H-acridin-9-one |
| SMILES | COc1cc2oc(=O)ccc2cc1C(C=C(C)C)c1c(OC)cc2[nH]c3c(OC)c(O)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C30H27NO8/c1-14(2)10-18(17-11-15-6-9-24(33)39-21(15)13-22(17)36-3)25-23(37-4)12-19-26(29(25)35)28(34)16-7-8-20(32)30(38-5)27(16)31-19/h6-13,18,32,35H,1-5H3,(H,31,34) |
| InChIKey | BUGYRWXAPBSPAH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|