C8H18N2O2 — CID 148861942
(2S,3R,6S)-3-amino-6-(ethylaminomethyl)oxan-2-ol (PubChem CID 148861942) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,3R,6S)-3-amino-6-(ethylaminomethyl)oxan-2-ol.
| Compound Name | (2S,3R,6S)-3-amino-6-(ethylaminomethyl)oxan-2-ol |
|---|---|
| PubChem CID | 148861942 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (2S,3R,6S)-3-amino-6-(ethylaminomethyl)oxan-2-ol |
| SMILES | CCNC[C@@H]1CC[C@@H](N)[C@@H](O)O1 |
| InChI | InChI=1S/C8H18N2O2/c1-2-10-5-6-3-4-7(9)8(11)12-6/h6-8,10-11H,2-5,9H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | OZMVEMLBJKAHCX-RNJXMRFFSA-N |
| XLogP | -0.58 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |