About 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane
2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane (PubChem CID 148863284) has the molecular formula C15H24F4
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane |
| PubChem CID | 148863284 |
| Molecular Formula | C15H24F4 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane |
| SMILES | CC(C)(C)C1CC(CC(C)(C)C2CC2(F)F)C1(F)F |
| InChI | InChI=1S/C15H24F4/c1-12(2,3)10-6-9(15(10,18)19)7-13(4,5)11-8-14(11,16)17/h9-11H,6-8H2,1-5H3 |
| InChIKey | OZTAJBZJEXQMJX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane?
The IUPAC name of 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane (CID 148863284) is 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane.
What is the SMILES notation for 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane?
The canonical SMILES for 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane is CC(C)(C)C1CC(CC(C)(C)C2CC2(F)F)C1(F)F.
What is the InChIKey of 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane?
The InChIKey is OZTAJBZJEXQMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F4/c1-12(2,3)10-6-9(15(10,18)19)7-13(4,5)11-8-14(11,16)17/h9-11H,6-8H2,1-5H3.
What are the key properties of 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane?
2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane has a molecular weight of 280.35 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[2-(2,2-difluorocyclopropyl)-2-methylpropyl]-1,1-difluorocyclobutane is sourced from PubChem (CID 148863284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).