C20H22N2O8 — CID 14887016
(2,3,4-triacetyloxy-4-quinoxalin-2-ylbutyl) acetate (PubChem CID 14887016) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is (2,3,4-triacetyloxy-4-quinoxalin-2-ylbutyl) acetate.
| Compound Name | (2,3,4-triacetyloxy-4-quinoxalin-2-ylbutyl) acetate |
|---|---|
| PubChem CID | 14887016 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (2,3,4-triacetyloxy-4-quinoxalin-2-ylbutyl) acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C20H22N2O8/c1-11(23)27-10-18(28-12(2)24)20(30-14(4)26)19(29-13(3)25)17-9-21-15-7-5-6-8-16(15)22-17/h5-9,18-20H,10H2,1-4H3 |
| InChIKey | CZCMCRIAFRGXRB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|