C10H12N2O5 — CID 148872014
(2R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]-5-oxa-7,9-diazatricyclo[4.4.0.02,4]deca-1(6),9-dien-8-one (PubChem CID 148872014) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]-5-oxa-7,9-diazatricyclo[4.4.0.02,4]deca-1(6),9-dien-8-one.
| Compound Name | (2R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]-5-oxa-7,9-diazatricyclo[4.4.0.02,4]deca-1(6),9-dien-8-one |
|---|---|
| PubChem CID | 148872014 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2R)-3-[(1R,2R)-1,2,3-trihydroxypropyl]-5-oxa-7,9-diazatricyclo[4.4.0.02,4]deca-1(6),9-dien-8-one |
| SMILES | O=c1ncc2c([nH]1)OC1C(C(O)[C@H](O)CO)[C@H]21 |
| InChI | InChI=1S/C10H12N2O5/c13-2-4(14)7(15)6-5-3-1-11-10(16)12-9(3)17-8(5)6/h1,4-8,13-15H,2H2,(H,11,12,16)/t4-,5+,6?,7?,8?/m1/s1 |
| InChIKey | PBJCEKUAIUMWJL-XSCIDGEOSA-N |
| XLogP | -2.04 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |