C24H32P2 — CID 148875541
(1R)-2-butyl-1-[(1R)-2-butyl-1,3-dihydroisophosphindol-1-yl]-1,3-dihydroisophosphindole (PubChem CID 148875541) has the molecular formula C24H32P2 and a molecular weight of 382.47 g/mol. Its IUPAC name is (1R)-2-butyl-1-[(1R)-2-butyl-1,3-dihydroisophosphindol-1-yl]-1,3-dihydroisophosphindole.
| Compound Name | (1R)-2-butyl-1-[(1R)-2-butyl-1,3-dihydroisophosphindol-1-yl]-1,3-dihydroisophosphindole |
|---|---|
| PubChem CID | 148875541 |
| Molecular Formula | C24H32P2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1R)-2-butyl-1-[(1R)-2-butyl-1,3-dihydroisophosphindol-1-yl]-1,3-dihydroisophosphindole |
| SMILES | CCCCP1Cc2ccccc2[C@@H]1[C@H]1c2ccccc2CP1CCCC |
| InChI | InChI=1S/C24H32P2/c1-3-5-15-25-17-19-11-7-9-13-21(19)23(25)24-22-14-10-8-12-20(22)18-26(24)16-6-4-2/h7-14,23-24H,3-6,15-18H2,1-2H3/t23-,24-,25?,26?/m1/s1 |
| InChIKey | JNZZMSJOOHVBMX-TYPLQMOASA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|