About 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole
2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole (PubChem CID 148876234) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole |
| PubChem CID | 148876234 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole |
| SMILES | CCC1Cc2cc(C)c(C)cc2N1 |
| InChI | InChI=1S/C12H17N/c1-4-11-7-10-5-8(2)9(3)6-12(10)13-11/h5-6,11,13H,4,7H2,1-3H3 |
| InChIKey | PCDPQVMHLVRHAB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole?
The IUPAC name of 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole (CID 148876234) is 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole?
The canonical SMILES for 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole is CCC1Cc2cc(C)c(C)cc2N1.
What is the InChIKey of 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole?
The InChIKey is PCDPQVMHLVRHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-11-7-10-5-8(2)9(3)6-12(10)13-11/h5-6,11,13H,4,7H2,1-3H3.
What are the key properties of 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole?
2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole has a molecular weight of 175.27 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-dimethyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 148876234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).