About 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole
4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole (PubChem CID 1488777) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole |
| PubChem CID | 1488777 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole |
| SMILES | Cc1oncc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C11H9N3O/c1-8-9(6-12-15-8)10-7-14-5-3-2-4-11(14)13-10/h2-7H,1H3 |
| InChIKey | WJWBBLLJYULSCU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole?
The IUPAC name of 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole (CID 1488777) is 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole is Cc1oncc1-c1cn2ccccc2n1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole?
The InChIKey is WJWBBLLJYULSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c1-8-9(6-12-15-8)10-7-14-5-3-2-4-11(14)13-10/h2-7H,1H3.
What are the key properties of 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole?
4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole has a molecular weight of 199.21 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-2-yl-5-methyl-1,2-oxazole is sourced from PubChem (CID 1488777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).