About 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole
5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole (PubChem CID 1488778) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole |
| PubChem CID | 1488778 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole |
| SMILES | Cc1ccn2cc(-c3cnoc3C)nc2c1 |
| InChI | InChI=1S/C12H11N3O/c1-8-3-4-15-7-11(14-12(15)5-8)10-6-13-16-9(10)2/h3-7H,1-2H3 |
| InChIKey | VFOLLJDHPQGEIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole?
The IUPAC name of 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole (CID 1488778) is 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole.
What is the SMILES notation for 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole?
The canonical SMILES for 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole is Cc1ccn2cc(-c3cnoc3C)nc2c1.
What is the InChIKey of 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole?
The InChIKey is VFOLLJDHPQGEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-8-3-4-15-7-11(14-12(15)5-8)10-6-13-16-9(10)2/h3-7H,1-2H3.
What are the key properties of 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole?
5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole has a molecular weight of 213.24 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(7-methylimidazo[1,2-a]pyridin-2-yl)-1,2-oxazole is sourced from PubChem (CID 1488778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).