C5H10N2O3 — CID 14888092
(3R,4R,5R)-3-amino-4,5-dihydroxypiperidin-2-one (PubChem CID 14888092) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is (3R,4R,5R)-3-amino-4,5-dihydroxypiperidin-2-one.
| Compound Name | (3R,4R,5R)-3-amino-4,5-dihydroxypiperidin-2-one |
|---|---|
| PubChem CID | 14888092 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (3R,4R,5R)-3-amino-4,5-dihydroxypiperidin-2-one |
| SMILES | N[C@H]1C(=O)NC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10N2O3/c6-3-4(9)2(8)1-7-5(3)10/h2-4,8-9H,1,6H2,(H,7,10)/t2-,3-,4+/m1/s1 |
| InChIKey | HCHNBOFMNHKJPL-JJYYJPOSSA-N |
| XLogP | -2.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |