About (Z)-1,4,7-trimethoxynon-3-ene
(Z)-1,4,7-trimethoxynon-3-ene (PubChem CID 14888382) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is (Z)-1,4,7-trimethoxynon-3-ene.
Molecular Properties
| Compound Name | (Z)-1,4,7-trimethoxynon-3-ene |
| PubChem CID | 14888382 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (Z)-1,4,7-trimethoxynon-3-ene |
| SMILES | CCC(CC/C(=C/CCOC)OC)OC |
| InChI | InChI=1S/C12H24O3/c1-5-11(14-3)8-9-12(15-4)7-6-10-13-2/h7,11H,5-6,8-10H2,1-4H3/b12-7- |
| InChIKey | CFNQURSOGPPXJB-GHXNOFRVSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,4,7-trimethoxynon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,4,7-trimethoxynon-3-ene?
The IUPAC name of (Z)-1,4,7-trimethoxynon-3-ene (CID 14888382) is (Z)-1,4,7-trimethoxynon-3-ene.
What is the SMILES notation for (Z)-1,4,7-trimethoxynon-3-ene?
The canonical SMILES for (Z)-1,4,7-trimethoxynon-3-ene is CCC(CC/C(=C/CCOC)OC)OC.
What is the InChIKey of (Z)-1,4,7-trimethoxynon-3-ene?
The InChIKey is CFNQURSOGPPXJB-GHXNOFRVSA-N. The full InChI is InChI=1S/C12H24O3/c1-5-11(14-3)8-9-12(15-4)7-6-10-13-2/h7,11H,5-6,8-10H2,1-4H3/b12-7-.
What are the key properties of (Z)-1,4,7-trimethoxynon-3-ene?
(Z)-1,4,7-trimethoxynon-3-ene has a molecular weight of 216.32 g/mol, XLogP of 2.76, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,4,7-trimethoxynon-3-ene is sourced from PubChem (CID 14888382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).