About 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine
2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine (PubChem CID 148886481) has the molecular formula C18H16ClN5
and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine |
| PubChem CID | 148886481 |
| Molecular Formula | C18H16ClN5 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine |
| SMILES | C/N=C/C(=C(N)c1cccnc1C)c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C18H16ClN5/c1-11-13(4-3-7-22-11)18(20)14(10-21-2)12-8-16-15(23-9-12)5-6-17(19)24-16/h3-10H,20H2,1-2H3/b18-14?,21-10+ |
| InChIKey | MZBREAVBYGUFAP-PNJNBRTESA-N |
| XLogP | 3.51 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine?
The IUPAC name of 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine (CID 148886481) is 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine.
What is the SMILES notation for 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine?
The canonical SMILES for 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine is C/N=C/C(=C(N)c1cccnc1C)c1cnc2ccc(Cl)nc2c1.
What is the InChIKey of 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine?
The InChIKey is MZBREAVBYGUFAP-PNJNBRTESA-N. The full InChI is InChI=1S/C18H16ClN5/c1-11-13(4-3-7-22-11)18(20)14(10-21-2)12-8-16-15(23-9-12)5-6-17(19)24-16/h3-10H,20H2,1-2H3/b18-14?,21-10+.
What are the key properties of 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine?
2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine has a molecular weight of 337.81 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-1,5-naphthyridin-3-yl)-3-methylimino-1-(2-methyl-3-pyridinyl)prop-1-en-1-amine is sourced from PubChem (CID 148886481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).